| Approval: | ISO common name not required |
|---|---|
| IUPAC PIN: | ethyl (naphthalen-1-yl)acetate |
| IUPAC name: | ethyl 1-naphthylacetate |
| CAS name: | ethyl 1-naphthaleneacetate |
| CAS Reg. No.: | 2122-70-5 |
| Formula: | C14H14O2 |
| Activity: | plant growth regulators (auxin) |
| Notes: | This substance is a derivative of 1-naphthaleneacetic acid [86-87-3]. |
| Structure: | |
| Pronunciation: | ē-thīl wǔn nǎf-tha-lēn-ǎs-ǐ-tāt Guide to British pronunciation |
| InChIKey: | XIDPSKQLXKCVQN-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H14O2/c1-2-16-14(15)10-12-8-5-7-11-6-3-4-9-13(11)12/h3-9H,2,10H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names