| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | trichloroacetic acid—N,N-dimethyl-N′-phenylurea (1/1) |
| IUPAC name: | 1,1-dimethyl-3-phenylurea - trichloroacetic acid (1:1) or 1,1-dimethyl-3-phenyluronium trichloroacetate |
| CAS name: | N,N-dimethyl-N′-phenylurea compound with 2,2,2-trichloroacetic acid (1:1) |
| CAS Reg. No.: | 4482-55-7 |
| Formula: | C11H13Cl3N2O3 |
| Activity: | herbicides (phenylurea) |
| Notes: | This substance is a derivative of fenuron [101-42-8] and TCA [76-03-9]. The name “fenuron-TCA” is approved by the Weed Science Society of America. |
| Structure: |  |
| Pronunciation: | fěn-ūr-ǒn tē sē ā Guide to British pronunciation |
| InChIKey: | XDWSZOWLJIWERG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H12N2O.C2HCl3O2/c1-11(2)9(12)10-8-6-4-3-5-7-8;3-2(4,5)1(6)7/h3-7H,1-2H3,(H,10,12);(H,6,7) |