| Approval: | Parent – ISO |
|---|---|
| IUPAC name: | isopropyl N-benzoyl-N-(3-chloro-4-fluorophenyl)-D-alaninate |
| CAS name: | 1-methylethyl N-benzoyl-N-(3-chloro-4-fluorophenyl)-D-alaninate |
| CAS Reg. No.: | 63782-90-1 |
| Formula: | C19H19ClFNO3 |
| Activity: | herbicides (arylaminopropionic acid) |
| Notes: | This substance is a derivative of flamprop-M [90134-59-1]. The unresolved racemic mixture of this substance has the ISO common name flamprop-isopropyl [52756-22-6]. |
| Structure: | |
| Pronunciation: | flǎm-prǒp ěm ī-sō-prō-pīl Guide to British pronunciation |
| InChIKey: | IKVXBIIHQGXQRQ-CYBMUJFWSA-N |
| InChI: | InChI=1S/C19H19ClFNO3/c1-12(2)25-19(24)13(3)22(15-9-10-17(21)16(20)11-15)18(23)14-7-5-4-6-8-14/h4-13H,1-3H3/t13-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names