| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | butyl 9-hydroxy-9H-fluorene-9-carboxylate |
| IUPAC name: | butyl 9-hydroxyfluorene-9-carboxylate |
| CAS name: | butyl 9-hydroxy-9H-fluorene-9-carboxylate |
| CAS Reg. No.: | 2314-09-2 |
| Formula: | C18H18O3 |
| Activity: | plant growth regulators (morphactin) |
| Notes: | This substance is a derivative of flurenol [467-69-6]. The name “flurecol-butyl” is used in Canada, Denmark and the USA. The name “芴丁酯” is approved in China for flurenol and for flurenol-butyl. |
| Structure: |  |
| Pronunciation: | flūr-ē-nǒl bū-tīl Guide to British pronunciation |
| InChIKey: | PSGPXWYGJGGEEG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C18H18O3/c1-2-3-12-21-17(19)18(20)15-10-6-4-8-13(15)14-9-5-7-11-16(14)18/h4-11,20H,2-3,12H2,1H3 |