| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | methyl 9-hydroxy-9H-fluorene-9-carboxylate |
| IUPAC name: | methyl 9-hydroxyfluorene-9-carboxylate |
| CAS name: | methyl 9-hydroxy-9H-fluorene-9-carboxylate |
| CAS Reg. No.: | 1216-44-0 |
| Formula: | C15H12O3 |
| Activity: | plant growth regulators (morphactin) |
| Notes: | This substance is a derivative of flurenol [467-69-6]. The name “flurecol-methyl” is used in Canada, Denmark and the USA. |
| Structure: |  |
| Pronunciation: | flūr-ē-nǒl mē-thīl Guide to British pronunciation |
| InChIKey: | AJKQZRAAQMBNKM-UHFFFAOYSA-N |
| InChI: | InChI=1S/C15H12O3/c1-18-14(16)15(17)12-8-4-2-6-10(12)11-7-3-5-9-13(11)15/h2-9,17H,1H3 |