| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | 4-cyano-2,6-diiodophenyl octanoate |
| IUPAC name: | 4-cyano-2,6-diiodophenyl octanoate |
| CAS name: | 4-cyano-2,6-diiodophenyl octanoate |
| CAS Reg. No.: | 3861-47-0 |
| Formula: | C15H17I2NO2 |
| Activity: | herbicides (hydroxybenzonitrile) |
| Notes: | This substance is a derivative of ioxynil [1689-83-4]. |
| Structure: | |
| Pronunciation: | ī-ǒks-ǐ-nǐl ǒk-ta-nō-āt Guide to British pronunciation |
| InChIKey: | QBEXFUOWUYCXNI-UHFFFAOYSA-N |
| InChI: | InChI=1S/C15H17I2NO2/c1-2-3-4-5-6-7-14(19)20-15-12(16)8-11(10-18)9-13(15)17/h8-9H,2-7H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names