| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | (4-chloro-2-methylphenoxy)acetic acid—2,2′,2″-nitrilotri(ethan-1-ol) (1/1) |
| IUPAC name: | [(4-chloro-o-tolyl)oxy]acetic acid - 2,2′,2″-nitrilotriethanol (1:1) or tris(2-hydroxyethyl)ammonium [(4-chloro-o-tolyl)oxy]acetate |
| CAS name: | 2-(4-chloro-2-methylphenoxy)acetic acid compound with 2,2′,2″-nitrilotris[ethanol] (1:1) |
| CAS Reg. No.: | 42459-68-7 |
| Formula: | C15H24ClNO6 |
| Activity: | herbicides (phenoxyacetic) |
| Notes: | This substance is a derivative of MCPA [94-74-6]. |
| Structure: | |
| Pronunciation: | ěm sē pē ā trǒl-a-mēn Guide to British pronunciation |
| InChIKey: | LWZVSTQWRNKGPB-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H9ClO3.C6H15NO3/c1-6-4-7(10)2-3-8(6)13-5-9(11)12;8-4-1-7(2-5-9)3-6-10/h2-4H,5H2,1H3,(H,11,12);8-10H,1-6H2 |
A data sheet from the Compendium of Pesticide Common Names