| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | sodium 4-(4-chloro-2-methylphenoxy)butanoate |
| IUPAC name: | sodium 4-[(4-chloro-o-tolyl)oxy]butyrate |
| CAS name: | sodium 4-(4-chloro-2-methylphenoxy)butanoate |
| CAS Reg. No.: | 6062-26-6 |
| Formula: | C11H12ClNaO3 |
| Activity: | herbicides (phenoxybutyric) |
| Notes: | This substance is a derivative of MCPB [94-81-5]. The name “2,4-MCPB-sodium” is used in France. |
| Structure: |  |
| Pronunciation: | ěm sē pē bē sō-dē-am Guide to British pronunciation |
| InChIKey: | GABUSZPTCJGKGB-UHFFFAOYSA-M |
| InChI: | InChI=1S/C11H13ClO3.Na/c1-8-7-9(12)4-5-10(8)15-6-2-3-11(13)14;/h4-5,7H,2-3,6H2,1H3,(H,13,14);/q;+1/p-1 |