| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | rac-(2R)-2-(4-chloro-2-methylphenoxy)propanoic acid—N-methylmethanamine (1/1) |
| IUPAC name: | (RS)-2-[(4-chloro-o-tolyl)oxy]propionic acid - dimethylamine (1:1) or dimethylammonium (RS)-2-[(4-chloro-o-tolyl)oxy]propionate |
| CAS name: | 2-(4-chloro-2-methylphenoxy)propanoic acid compound with N-methylmethanamine (1:1) |
| CAS Reg. No.: | 32351-70-5 |
| Formula: | C12H18ClNO3 |
| Activity: | herbicides (phenoxypropionic) |
| Notes: | This substance is a derivative of mecoprop [93-65-2]. The (+)-enantiomer of this substance has the ISO common name mecoprop-P-dimethylammonium [66423-09-4]. |
| Structure: |  |
| Pronunciation: | měk-o-prǒp dī-mē-thīl-a-mōn-ē-am Guide to British pronunciation |
| InChIKey: | ROGDGDPDLIVQFZ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H11ClO3.C2H7N/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;1-3-2/h3-5,7H,1-2H3,(H,12,13);3H,1-2H3 |