Status: | modified ISO 1750 (published) |
---|---|
IUPAC PIN: | rac-methyl (2R)-2-(4-chloro-2-methylphenoxy)propanoate |
IUPAC name: | methyl (RS)-2-[(4-chloro-o-tolyl)oxy]propionate |
CAS name: | methyl 2-(4-chloro-2-methylphenoxy)propanoate |
CAS Reg. No.: | 2786-19-8 |
Formula: | C11H13ClO3 |
Activity: | herbicides (phenoxypropionic) |
Notes: | This substance is a derivative of mecoprop [93-65-2]. |
Structure: | |
Pronunciation: | měk-o-prǒp mē-thīl Guide to British pronunciation |
InChIKey: | YWGAULPFWIQKRB-UHFFFAOYSA-N |
InChI: | InChI=1S/C11H13ClO3/c1-7-6-9(12)4-5-10(7)15-8(2)11(13)14-3/h4-6,8H,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names