| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | 1,1-dimethylpiperidin-1-ium chloride |
| IUPAC name: | 1,1-dimethylpiperidinium chloride |
| CAS name: | 1,1-dimethylpiperidinium chloride |
| CAS Reg. No.: | 24307-26-4 |
| Formula: | C7H16ClN |
| Activity: | plant growth regulators (growth inhibitor) |
| Notes: | This substance is a derivative of mepiquat [15302-91-7]. The Chinese name “缩节胺” has also been used in the literature, but it has no official approval. |
| Structure: |  |
| Pronunciation: | mě-pǐ-kwǒt klor-īd Guide to British pronunciation |
| InChIKey: | VHOVSQVSAAQANU-UHFFFAOYSA-M |
| InChI: | InChI=1S/C7H16N.ClH/c1-8(2)6-4-3-5-7-8;/h3-7H2,1-2H3;1H/q+1;/p-1 |