| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | (5-bromo-6-oxo-1-phenyl-1,6-dihydropyridazin-4-yl)oxamic acid—2-(dimethylamino)ethan-1-ol (1/1) |
| IUPAC name: | (5-bromo-1,6-dihydro-6-oxo-1-phenylpyridazin-4-yl)oxamic acid - 2-(dimethylamino)ethanol (1:1) or (2-hydroxyethyl)dimethylammonium (5-bromo-1,6-dihydro-6-oxo-1-phenylpyridazin-4-yl)oxamate |
| CAS name: | 2-[(5-bromo-1,6-dihydro-6-oxo-1-phenyl-4-pyridazinyl)amino]-2-oxoacetic acid compound with 2-(dimethylamino)ethanol (1:1) |
| CAS Reg. No.: | 25316-57-8 |
| Formula: | C16H19BrN4O5 |
| Activity: | herbicides (pyridazinone) |
| Notes: | This substance is a derivative of oxapyrazon [4489-31-0]. The name “oxapyrazone-dimolamine” was formerly approved by the British Standards Institution. |
| Structure: | |
| Pronunciation: | ǒks-a-pǐr-a-zǒn dī-mǒl-a-mēn Guide to British pronunciation |
| InChIKey: | ZAIWHXZLOUBQCG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H8BrN3O4.C4H11NO/c13-9-8(15-10(17)12(19)20)6-14-16(11(9)18)7-4-2-1-3-5-7;1-5(2)3-4-6/h1-6H,(H,15,17)(H,19,20);6H,3-4H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names