| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | rac-(2R)-2-ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| IUPAC name: | (RS)-2-ethylhexyl 4-amino-3,5,6-trichloropyridine-2-carboxylate or (RS)-2-ethylhexyl 4-amino-3,5,6-trichloropicolinate |
| CAS name: | 2-ethylhexyl 4-amino-3,5,6-trichloro-2-pyridinecarboxylate |
| CAS Reg. No.: | 36374-99-9 |
| Formula: | C14H19Cl3N2O2 |
| Activity: | herbicides (pyridinecarboxylic acid) |
| Notes: | This substance is a derivative of picloram [1918-02-1]. This substance was previously known as picloram-2-ethylhexyl. |
| Structure: |  |
| Pronunciation: | pǐ-klor-ǎm ē-těks-īl Guide to British pronunciation |
| InChIKey: | RPDJBUSVCYFTRU-UHFFFAOYSA-N |
| InChI: | InChI=1S/C14H19Cl3N2O2/c1-3-5-6-8(4-2)7-21-14(20)12-9(15)11(18)10(16)13(17)19-12/h8H,3-7H2,1-2H3,(H2,18,19) |