| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | rac-1-[(3R)-3,7-dimethyloctyl]-1-(prop-2-en-1-yl)piperidin-1-ium bromide |
| IUPAC name: | (RS)-1-allyl-1-(3,7-dimethyloctyl)piperidinium bromide |
| CAS name: | 1-(3,7-dimethyloctyl)-1-(2-propenyl)piperidinium bromide |
| CAS Reg. No.: | 56717-11-4 |
| Formula: | C18H36BrN |
| Activity: | plant growth regulators (growth inhibitor) |
| Notes: | This substance is a derivative of piproctanyl [69309-47-3]. The name “哌壮素” is approved in China for piproctanyl and for piproctanyl bromide. |
| Structure: | |
| Pronunciation: | pǐ-prǒk-ta-nīl brō-mīd Guide to British pronunciation |
| InChIKey: | LNJLLOLFPPCXOR-UHFFFAOYSA-M |
| InChI: | InChI=1S/C18H36N.BrH/c1-5-13-19(14-7-6-8-15-19)16-12-18(4)11-9-10-17(2)3;/h5,17-18H,1,6-16H2,2-4H3;1H/q+1;/p-1 |
A data sheet from the Compendium of Pesticide Common Names