| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | sodium O-propan-2-yl carbonodithioate |
| IUPAC name: | sodium O-isopropyl dithiocarbonate |
| CAS name: | sodium O-(1-methylethyl) carbonodithioate |
| CAS Reg. No.: | 140-93-2 |
| Formula: | C4H7NaOS2 |
| Activity: | herbicides (thiocarbonate) |
| Notes: | This substance is a derivative of proxan [108-25-8]. The name “proxan-sodium” was formerly approved by ISO for the sodium salt, but this was replaced by the name “proxan” for the monoisopropyl ester. |
| Structure: |  |
| Pronunciation: | prǒks-ǎn sō-dē-am Guide to British pronunciation |
| InChIKey: | IRZFQKXEKAODTJ-UHFFFAOYSA-M |
| InChI: | InChI=1S/C4H8OS2.Na/c1-3(2)5-4(6)7;/h3H,1-2H3,(H,6,7);/q;+1/p-1 |