| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | methyl 3,7-dichloroquinoline-8-carboxylate |
| IUPAC name: | methyl 3,7-dichloroquinoline-8-carboxylate |
| CAS name: | methyl 3,7-dichloro-8-quinolinecarboxylate |
| CAS Reg. No.: | 84087-33-2 |
| Formula: | C11H7Cl2NO2 |
| Activity: | herbicides (quinolinecarboxylic acid) |
| Notes: | This substance is a derivative of quinclorac [84087-01-4]. |
| Structure: | |
| Pronunciation: | kwǐn-klor-ǎk mē-thīl Guide to British pronunciation |
| InChIKey: | LNKVWJBNESETCJ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H7Cl2NO2/c1-16-11(15)9-8(13)3-2-6-4-7(12)5-14-10(6)9/h2-5H,1H3 |
A data sheet from the Compendium of Pesticide Common Names