| Approval: | Parent - China |
|---|---|
| IUPAC name: | (EZ)-N1-methyl-N2-(2,4-xylyl)formamidine hydrochloride |
| CAS name: | N-(2,4-dimethylphenyl)-N′-methylmethanimidamide hydrochloride (1:1) |
| CAS Reg. No.: | 51550-40-4 |
| Formula: | C10H15ClN2 |
| Activity: | acaricides (formamidine) insecticides (formamidine) |
| Notes: | This substance is a derivative of semiamitraz [33089-74-6]. The ISO-style name “semiamitraz hydrochloride” has been used in the literature, but it has no official approval. |
| Structure: |  |
| Pronunciation: | sěm-ē-ǎm-ǐ-trǎz klor-ǐd Guide to British pronunciation |
| InChIKey: | VXSNJXDZTGFDMB-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H14N2.ClH/c1-8-4-5-10(9(2)6-8)12-7-11-3;/h4-7H,1-3H3,(H,11,12);1H |