| Approval: | Parent – ISO |
|---|---|
| IUPAC PIN: | ethyl [(3,5,6-trichloropyridin-2-yl)oxy]acetate |
| IUPAC name: | ethyl [(3,5,6-trichloro-2-pyridyl)oxy]acetate |
| CAS name: | ethyl 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate |
| CAS Reg. No.: | 60825-27-6 |
| Formula: | C9H8Cl3NO3 |
| Activity: | herbicides (pyridyloxycarboxylic acid) |
| Notes: | This substance is a derivative of triclopyr [55335-06-3]. |
| Structure: | |
| Pronunciation: | trī-klō-pīr ē-thīl Guide to British pronunciation |
| InChIKey: | KXAVVWXJUDQGDA-UHFFFAOYSA-N |
| InChI: | InChI=1S/C9H8Cl3NO3/c1-2-15-7(14)4-16-9-6(11)3-5(10)8(12)13-9/h3H,2,4H2,1H3 |
A data sheet from the Compendium of Pesticide Common Names