| Approval: | ISO |
|---|---|
| IUPAC PIN: | 2,6-dichlorobenzonitrile |
| IUPAC name: | 2,6-dichlorobenzonitrile |
| CAS name: | 2,6-dichlorobenzonitrile |
| CAS Reg. No.: | 1194-65-6 |
| Formula: | C7H3Cl2N |
| Activity: | herbicides (benzonitrile) |
| Notes: | |
| Structure: | |
| Pronunciation: | dī-klō-běn-ǐl Guide to British pronunciation |
| InChIKey: | YOYAIZYFCNQIRF-UHFFFAOYSA-N |
| InChI: | InChI=1S/C7H3Cl2N/c8-6-2-1-3-7(9)5(6)4-10/h1-3H |
A data sheet from the Compendium of Pesticide Common Names