| Approval: | USSR |
|---|---|
| IUPAC PIN: | mixture of 2-methylphenyl methylcarbamate, 3-methylphenyl methylcarbamate and 4-methylphenyl methylcarbamate |
| IUPAC name: | cresyl methylcarbamate |
| CAS name: | methylphenyl N-methylcarbamate |
| CAS Reg. No.: | 58481-70-2 |
| Formula: | C9H11NO2 |
| Activity: | insecticides (phenyl carbamate) |
| Notes: | There is no ISO common name for this substance; the name “dicresyl” (дикрезил) was used in the former USSR. The 3-methyl isomer has the ISO common name metolcarb [1129-41-5]. |
| Structure: |  |
| Pronunciation: | dī-krē-sīl Guide to British pronunciation |
| InChIKey: | o-cresyl methylcarbamate: JDIMVGGWYBWUIS-UHFFFAOYSA-N m-cresyl methylcarbamate: VOEYXMAFNDNNED-UHFFFAOYSA-N p-cresyl methylcarbamate: ZHXCDUWUCWUEPJ-UHFFFAOYSA-N |
| InChI: | o-cresyl methylcarbamate: InChI=1S/C9H11NO2/c1-7-5-3-4-6-8(7)12-9(11)10-2/h3-6H,1-2H3,(H,10,11) m-cresyl methylcarbamate: InChI=1S/C9H11NO2/c1-7-4-3-5-8(6-7)12-9(11)10-2/h3-6H,1-2H3,(H,10,11) p-cresyl methylcarbamate: InChI=1S/C9H11NO2/c1-7-3-5-8(6-4-7)12-9(11)10-2/h3-6H,1-2H3,(H,10,11) |