| Approval: | ESA |
|---|---|
| IUPAC PIN: | 5,5-dimethyl-3-oxocyclohex-1-en-1-yl dimethylcarbamate |
| IUPAC name: | 5,5-dimethyl-3-oxocyclohex-1-en-1-yl dimethylcarbamate |
| CAS name: | 5,5-dimethyl-3-oxo-1-cyclohexen-1-yl N,N-dimethylcarbamate |
| CAS Reg. No.: | 122-15-6 |
| Formula: | C11H17NO3 |
| Activity: | insecticides (dimethylcarbamate) |
| Notes: | There is no ISO common name for this substance; the name “dimetan” is approved by the Entomological Society of America, and is also approved in China (地麦威). |
| Structure: | |
| Pronunciation: | dī-mē-tǎn Guide to British pronunciation |
| InChIKey: | ITEQSCBLCCNACE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H17NO3/c1-11(2)6-8(13)5-9(7-11)15-10(14)12(3)4/h5H,6-7H2,1-4H3 |
A data sheet from the Compendium of Pesticide Common Names