| Approval: | ISO |
|---|---|
| IUPAC PIN: | 1-(dimethylcarbamoyl)-5-methyl-1H-pyrazol-3-yl dimethylcarbamate |
| IUPAC name: | 1-(dimethylcarbamoyl)-5-methyl-1H-pyrazol-3-yl dimethylcarbamate |
| CAS name: | 1-[(dimethylamino)carbonyl]-5-methyl-1H-pyrazol-3-yl N,N-dimethylcarbamate |
| CAS Reg. No.: | 644-64-4 |
| Formula: | C10H16N4O3 |
| Activity: | insecticides (dimethylcarbamate) |
| Notes: | The name “dimetilan” was formerly approved by the British Standards Institution. |
| Structure: | |
| Pronunciation: | di-mět-ǐ-lǎn Guide to British pronunciation |
| InChIKey: | RDBIYWSVMRVKSG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H16N4O3/c1-7-6-8(17-10(16)13(4)5)11-14(7)9(15)12(2)3/h6H,1-5H3 |
A data sheet from the Compendium of Pesticide Common Names