| Approved: | ISO |
|---|---|
| IUPAC PIN: | rac-N-ethyl-5-methyl-1-[(2R)-3-methylbutan-2-yl]-N-(pyridazin-4-yl)-1H-pyrazole-4-carboxamide |
| IUPAC name: | 1-[(1RS)-1,2-dimethylpropyl]-N-ethyl-5-methyl-N-pyridazin-4-yl-1H-pyrazole-4-carboxamide |
| CAS name: | 1-(1,2-dimethylpropyl)-N-ethyl-5-methyl-N-4-pyridazinyl-1H-pyrazole-4-carboxamide |
| CAS Reg. No.: | 1403615-77-9 |
| Formula: | C16H23N5O |
| Activity: | insecticides (pyrazolecarboxamide) |
| Notes: | |
| Structure: | |
| Pronunciation: | dǐm-prō-pīr-ǐ-dǎz Guide to British pronunciation |
| InChIKey: | NQPGZXOPMRKAGJ-UHFFFAOYSA-N |
| InChI: | InChI=1S/C16H23N5O/c1-6-20(14-7-8-17-18-9-14)16(22)15-10-19-21(13(15)5)12(4)11(2)3/h7-12H,6H2,1-5H3 |
A data sheet from the Compendium of Pesticide Common Names