imidazolinone herbicides
Approval: | ISO |
---|---|
IUPAC PIN: | rac-2-[(2R)-butan-2-yl]-4,6-dinitrophenyl 2,4-dinitrophenyl carbonate |
IUPAC name: | 2,4-dinitrophenyl 2-[(1RS)-1-methylpropyl]-4,6-dinitrophenyl carbonate 1979 Rules: (RS)-2-sec-butyl-4,6-dinitrophenyl 2,4-dinitrophenyl carbonate |
CAS name: | 2,4-dinitrophenyl 2-(1-methylpropyl)-4,6-dinitrophenyl carbonate |
CAS Reg. No.: | 61614-62-8 |
Formula: | C17H14N4O11 |
Activity: | herbicides (dinitrophenol) |
Notes: | The name “dinofenate” was formerly approved by the British Standards Institution and was adopted by ISO in 2020. |
Structure: | |
Pronunciation: | dī-nō-fěn-āt Guide to British pronunciation |
InChIKey: | HEJVROKEIMJTIN-UHFFFAOYSA-N |
InChI: | InChI=1S/C17H14N4O11/c1-3-9(2)12-6-11(19(25)26)8-14(21(29)30)16(12)32-17(22)31-15-5-4-10(18(23)24)7-13(15)20(27)28/h4-9H,3H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names