| Approval: | ISO |
|---|---|
| IUPAC PIN: | rac-2-[(2R)-butan-2-yl]-4,6-dinitrophenol |
| IUPAC name: | 2-[(1RS)-1-methylpropyl]-4,6-dinitrophenol 1979 Rules: (RS)-2-sec-butyl-4,6-dinitrophenol |
| CAS name: | 2-(1-methylpropyl)-4,6-dinitrophenol |
| CAS Reg. No.: | 88-85-7 |
| Formula: | C10H12N2O5 |
| Activity: | herbicides (dinitrophenol) |
| Notes: | Derivatives include dinoseb acetate [2813-95-8], dinoseb-ammonium [6365-83-9], dinoseb-diolamine [53404-43-6], dinoseb-sodium [35040-03-0], dinoseb-trolamine [6420-47-9]. The 3-methyl-2-butenoate ester has its own ISO common name, binapacryl [485-31-4]. |
| Structure: | |
| Pronunciation: | dī-nō-sěb Guide to British pronunciation |
| InChIKey: | OWZPCEFYPSAJFR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H12N2O5/c1-3-6(2)8-4-7(11(14)15)5-9(10(8)13)12(16)17/h4-6,13H,3H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names