Status: | China |
---|---|
IUPAC PIN: | 4-methyl-2,6-dinitro-N,N-dipropylaniline |
IUPAC name: | 4-methyl-2,6-dinitro-N,N-dipropylaniline 1979 Rules: 2,6-dinitro-N,N-dipropyl-p-toluidine |
CAS name: | 4-methyl-2,6-dinitro-N,N-dipropylbenzenamine |
CAS Reg. No.: | 1918-08-7 |
Formula: | C13H19N3O4 |
Activity: | herbicides (dinitroaniline) |
Notes: | There is no ISO common name for this substance; the name “dipropalin” (地乐灵) is approved in China. |
Structure: | |
Pronunciation: | dī-prōp-a-lǐn Guide to British pronunciation |
InChIKey: | UDVZOMAEGATTSE-UHFFFAOYSA-N |
InChI: | InChI=1S/C13H19N3O4/c1-4-6-14(7-5-2)13-11(15(17)18)8-10(3)9-12(13)16(19)20/h8-9H,4-7H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names