Approval: | none |
---|---|
IUPAC PIN: | mixture of (2S)-pentan-2-yl (2E)-2,4-dimethylpent-2-enoate and (2S)-pentan-2-yl (2E)-2-methylpent-2-enoate |
IUPAC name: | mixture of (S)-1-methylbutyl (E)-2,4-dimethylpent-2-enoate and (S)-1-methylbutyl (E)-2-methylpent-2-enoate |
CAS name: | (1S)-1-methylbutyl (2E)-2,4-dimethyl-2-pentenoate mixture with (1S)-1-methylbutyl (2E)-2-methyl-2-pentenoate |
CAS Reg. No.: | 80510-16-3 + 80510-15-2 |
Formula: | C12H22O2 + C11H20O2 |
Activity: | insect attractants (Coleopteran) |
Notes: | There is no ISO common name for this substance; the name “dominicalure” has been used in the literature but it has no official approval. This substance is named after the insect from which it was isolated, Rhyzopertha dominica (Fabricius) (Bostrichidae, Coleoptera). |
Structure: | |
Pronunciation: | dǒ-mǐ-nē-ka-lūr Guide to British pronunciation |
InChIKey: | (1S)-1-methylbutyl (2E)-2,4-dimethyl-2-pentenoate: FSYDYWBQQJBBIE-UQSGXBNBSA-N (1S)-1-methylbutyl (2E)-2-methyl-2-pentenoate: HPKANHQEOBMBEF-PCYYEKQGSA-N identifier for mixture (not valid): VYESLYISRDNYHY-XZOLHLMBSA-N |
InChI: | (1S)-1-methylbutyl (2E)-2,4-dimethyl-2-pentenoate: InChI=1S/C12H22O2/c1-6-7-11(5)14-12(13)10(4)8-9(2)3/h8-9,11H,6-7H2,1-5H3/b10-8-/t11-/m0/s1 (1S)-1-methylbutyl (2E)-2-methyl-2-pentenoate: InChI=1S/C11H20O2/c1-5-7-9(3)11(12)13-10(4)8-6-2/h7,10H,5-6,8H2,1-4H3/b9-7-/t10-/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names