Approval: | ISO |
---|---|
IUPAC name: | N-[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]glycine |
CAS name: | N-[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]glycine |
CAS Reg. No.: | 68228-19-3 |
Formula: | C7H10ClN5O2 |
Activity: | herbicides (chlorotriazine) |
Notes: | When this substance is used as an ester or a salt, its identity should be stated, for example eglinazine-ethyl [6616-80-4]. |
Structure: | |
Pronunciation: | ě-glǐn-a-zēn Guide to British pronunciation |
InChIKey: | IAUFMJOLSFEAIJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C7H10ClN5O2/c1-2-9-6-11-5(8)12-7(13-6)10-3-4(14)15/h2-3H2,1H3,(H,14,15)(H2,9,10,11,12,13) |
A data sheet from the Compendium of Pesticide Common Names