| Approval: | China |
|---|---|
| IUPAC PIN: | 2-chloro-N-(ethoxymethyl)-N-(2-ethylphenyl)acetamide |
| IUPAC name: | 2-chloro-N-(ethoxymethyl)-2′-ethylacetanilide |
| CAS name: | 2-chloro-N-(ethoxymethyl)-N-(2-ethylphenyl)acetamide |
| CAS Reg. No.: | 51218-31-6 |
| Formula: | C13H18ClNO2 |
| Activity: | herbicides (chloroacetamide) |
| Notes: | There is no ISO common name for this substance; the name “ethachlor” (克草胺) is approved in China. |
| Structure: | |
| Pronunciation: | ēth-a-klor Guide to British pronunciation |
| InChIKey: | QJTJSFKYIUWWJE-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H18ClNO2/c1-3-11-7-5-6-8-12(11)15(10-17-4-2)13(16)9-14/h5-8H,3-4,9-10H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names