| Approval: | USP |
|---|---|
| IUPAC PIN: | (2Ξ,3Ξ)-2-ethylhexane-1,3-diol |
| IUPAC name: | (2RS,3RS;2RS,3SR)-2-ethylhexane-1,3-diol |
| CAS name: | 2-ethyl-1,3-hexanediol |
| CAS Reg. No.: | 94-96-2 |
| Formula: | C8H18O2 |
| Activity: | insect repellents |
| Notes: | There is no ISO common name for this substance; the name “ethohexadiol” is approved by the US Pharmacopoeia, and is also approved in China (驱蚊醇). |
| Structure: | |
| Pronunciation: | ē-thō-hěks-a-dī-ǒl Guide to British pronunciation |
| InChIKey: | RWLALWYNXFYRGW-UHFFFAOYSA-N |
| InChI: | InChI=1S/C8H18O2/c1-3-5-8(10)7(4-2)6-9/h7-10H,3-6H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names