| Approval: | none |
|---|---|
| IUPAC PIN: | 1,1′-(2,2-dichloroethane-1,1-diyl)bis(4-ethylbenzene) |
| IUPAC name: | 1,1-dichloro-2,2-bis(4-ethylphenyl)ethane |
| CAS name: | 1,1′-(2,2-dichloroethylidene)bis[4-ethylbenzene] |
| CAS Reg. No.: | 72-56-0 |
| Formula: | C18H20Cl2 |
| Activity: | insecticides (organochlorine) |
| Notes: | There is no ISO common name for this substance; the names “ethyl-DDD” and “ethylan” have been used in the literature but they have no official approval. The name “perthane” was rejected as an ISO common name for this substance and was later registered as a trademark. |
| Structure: | |
| Pronunciation: | ē-thīl dē dē dē Guide to British pronunciation |
| InChIKey: | QFMDFTQOJHFVNR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C18H20Cl2/c1-3-13-5-9-15(10-6-13)17(18(19)20)16-11-7-14(4-2)8-12-16/h5-12,17-18H,3-4H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names