| Approval: | WSSA |
|---|---|
| IUPAC PIN: | O,O-diethyl 2-(dithioperoxy)-1,3-dithiodicarbonate |
| IUPAC name: | O,O-diethyl dithiobis(thioformate) |
| CAS name: | thioperoxydicarbonic acid ([(HO)C(S)]2S2) diethyl ester |
| CAS Reg. No.: | 502-55-6 |
| Formula: | C6H10O2S4 |
| Activity: | herbicides (thiocarbonate) insecticides (thiocarbonate) |
| Notes: | There is no ISO common name for this substance; the name “EXD” is approved by the Weed Science Society of America and the name “dixanthogen” is approved by the World Health Organization. The analogous dimethyl ester has the WSSA common name dimexano [1468-37-7]. |
| Structure: | |
| Pronunciation: | ē ěks dē Guide to British pronunciation |
| InChIKey: | FVIGODVHAVLZOO-UHFFFAOYSA-N |
| InChI: | InChI=1S/C6H10O2S4/c1-3-7-5(9)11-12-6(10)8-4-2/h3-4H2,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names