Approval: | ISO |
---|---|
IUPAC PIN: | ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate |
IUPAC name: | ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate |
CAS name: | ethyl N-[2-(4-phenoxyphenoxy)ethyl]carbamate |
CAS Reg. No.: | 72490-01-8 |
Formula: | C17H19NO4 |
Activity: | insecticides (juvenile hormone mimic) |
Notes: | The CAS Registry Number 79127-80-3 was formerly used. |
Structure: | |
Pronunciation: | fěn-ǒk-sē-karb Guide to British pronunciation |
InChIKey: | HJUFTIJOISQSKQ-UHFFFAOYSA-N |
InChI: | InChI=1S/C17H19NO4/c1-2-20-17(19)18-12-13-21-14-8-10-16(11-9-14)22-15-6-4-3-5-7-15/h3-11H,2,12-13H2,1H3,(H,18,19) |
A data sheet from the Compendium of Pesticide Common Names