| Approval: | ISO |
|---|---|
| IUPAC PIN: | (Ξ)-cyano(6-phenoxypyridin-2-yl)methyl (1Ξ,3Ξ)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| IUPAC name: | (RS)-cyano(6-phenoxy-2-pyridyl)methyl (1RS,3RS;1RS,3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
| CAS name: | cyano(6-phenoxy-2-pyridinyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
| CAS Reg. No.: | 68523-18-2 |
| Formula: | C21H18Cl2N2O3 |
| Activity: | insecticides (pyrethroid) |
| Notes: | |
| Structure: | |
| Pronunciation: | fěn-pǐr-ǐ-thrǐn Guide to British pronunciation |
| InChIKey: | IHVPAVRHNZFQKC-UHFFFAOYSA-N |
| InChI: | InChI=1S/C21H18Cl2N2O3/c1-21(2)14(11-17(22)23)19(21)20(26)28-16(12-24)15-9-6-10-18(25-15)27-13-7-4-3-5-8-13/h3-11,14,16,19H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names