| Approval: | BAN |
|---|---|
| IUPAC PIN: | (Ξ)-cyano(4-fluoro-3-phenoxyphenyl)methyl (1Ξ,3Ξ)-3-[(1Ξ)-2-chloro-2-(4-chlorophenyl)ethenyl]-2,2-dimethylcyclopropane-1-carboxylate |
| IUPAC name: | (RS)-α-cyano-4-fluoro-3-phenoxybenzyl (1RS,3RS;1RS,3SR)-(EZ)-3-(β,4-dichlorostyryl)-2,2-dimethylcyclopropanecarboxylate or (RS)-α-cyano-4-fluoro-3-phenoxybenzyl (1RS)-cis-trans-(EZ)-3-(β,4-dichlorostyryl)-2,2-dimethylcyclopropanecarboxylate |
| CAS name: | cyano(4-fluoro-3-phenoxyphenyl)methyl 3-[2-chloro-2-(4-chlorophenyl)ethenyl]-2,2-dimethylcyclopropanecarboxylate |
| CAS Reg. No.: | 69770-45-2 |
| Formula: | C28H22Cl2FNO3 |
| Activity: | acaricides (pyrethroid) |
| Notes: | There is no ISO common name for this substance; the name “flumethrin” is approved by the British Pharmacopoeia Commission, and is also approved in China (氟氯苯菊酯). |
| Structure: | |
| Pronunciation: | floo-mēth-rǐn Guide to British pronunciation |
| InChIKey: | YXWCBRDRVXHABN-UHFFFAOYSA-N |
| InChI: | InChI=1S/C28H22Cl2FNO3/c1-28(2)21(15-22(30)17-8-11-19(29)12-9-17)26(28)27(33)35-25(16-32)18-10-13-23(31)24(14-18)34-20-6-4-3-5-7-20/h3-15,21,25-26H,1-2H3 |
A data sheet from the Compendium of Pesticide Common Names