| Approval: | ISO |
|---|---|
| IUPAC PIN: | 1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)benzene |
| IUPAC name: | 2,4-dichloro-6-fluorophenyl 4-nitrophenyl ether |
| CAS name: | 1,5-dichloro-3-fluoro-2-(4-nitrophenoxy)benzene |
| CAS Reg. No.: | 13738-63-1 |
| Formula: | C12H6Cl2FNO3 |
| Activity: | herbicides (diphenyl ether) |
| Notes: | |
| Structure: | |
| Pronunciation: | floo-or-ō-nī-trō-fěn Guide to British pronunciation |
| InChIKey: | MVHWKYHDYCGNQN-UHFFFAOYSA-N |
| InChI: | InChI=1S/C12H6Cl2FNO3/c13-7-5-10(14)12(11(15)6-7)19-9-3-1-8(2-4-9)16(17)18/h1-6H |
A data sheet from the Compendium of Pesticide Common Names