| Approval: | ISO |
|---|---|
| IUPAC PIN: | 3-{[(Ξ)-(dimethylamino)methylidene]amino}phenyl methylcarbamate |
| IUPAC name: | 3-{[(EZ)-(dimethylamino)methylidene]amino}phenyl methylcarbamate 1979 Rules: 3-{[(EZ)-(dimethylamino)methylene]amino}phenyl methylcarbamate |
| CAS name: | N,N-dimethyl-N′-[3-[[(methylamino)carbonyl]oxy]phenyl]methanimidamide |
| CAS Reg. No.: | 22259-30-9 |
| Formula: | C11H15N3O2 |
| Activity: | acaricides (carbamate) insecticides (carbamate) |
| Notes: | Derivatives include formetanate hydrochloride [23422-53-9]. The name “伐虫脒” is approved in China for formetanate and for formetanate hydrochloride. |
| Structure: |  |
| Pronunciation: | for-mět-a-nāt Guide to British pronunciation |
| InChIKey: | RMFNNCGOSPBBAD-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H15N3O2/c1-12-11(15)16-10-6-4-5-9(7-10)13-8-14(2)3/h4-8H,1-3H3,(H,12,15) |