Approval: | ISO |
---|---|
IUPAC PIN: | 4-{[(Ξ)-(dimethylamino)methylidene]amino}-3-methylphenyl methylcarbamate |
IUPAC name: | 4-{[(EZ)-(dimethylamino)methylidene]amino}-3-methylphenyl methylcarbamate 1979 Rules: 4-{[(EZ)-(dimethylamino)methylene]amino}-m-tolyl methylcarbamate |
CAS name: | N,N-dimethyl-N′-[2-methyl-4-[[(methylamino)carbonyl]oxy]phenyl]methanimidamide |
CAS Reg. No.: | 17702-57-7 |
Formula: | C12H17N3O2 |
Activity: | acaricides (carbamate) insecticides (carbamate) |
Notes: | When this substance is used as a salt, its identity should be stated, for example formparanate hydrochloride [35452-92-7]. |
Structure: | |
Pronunciation: | form-pǎr-a-nāt Guide to British pronunciation |
InChIKey: | NPCUJHYOBSHUJJ-UHFFFAOYSA-N |
InChI: | InChI=1S/C12H17N3O2/c1-9-7-10(17-12(16)13-2)5-6-11(9)14-8-15(3)4/h5-8H,1-4H3,(H,13,16) |
A data sheet from the Compendium of Pesticide Common Names