| Approval: | USSR |
|---|---|
| IUPAC PIN: | mixture of rac-(2R)-1-chloro-3-fluoropropan-2-ol and 1,3-difluoropropan-2-ol |
| IUPAC name: | mixture of (2RS)-1-chloro-3-fluoropropan-2-ol and 1,3-difluoropropan-2-ol |
| CAS name: | 1-chloro-3-fluoro-2-propanol mixture with 1,3-difluoro-2-propanol |
| CAS Reg. No.: | 8065-71-2 |
| Formula: | C3H6ClFO mixture with C3H6F2O |
| Activity: | rodenticides (unclassified) |
| Notes: | There is no ISO common name for this substance; the name “gliftor” (глифтор) was used in the former USSR, and is approved in China ( 鼠甘伏), but is incorrectly spelled “glitor” in GB 4839-2009 Chinese common names for pesticides. The CAS Registry Numbers of the components are 453-11-2 (C3H6ClFO) and 453-13-4 (C3H6F2O). |
| Structure: |  |
| Pronunciation: | glǐf-tor Guide to British pronunciation |
| InChIKey: | 1-chloro-3-fluoro-2-propanol: ZNKJYZHZWALQNX-UHFFFAOYSA-N 1,3-difluoro-2-propanol: PVDLUGWWIOGCNH-UHFFFAOYSA-N |
| InChI: | 1-chloro-3-fluoro-2-propanol: InChI=1S/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 1,3-difluoro-2-propanol: InChI=1S/C3H6F2O/c4-1-3(6)2-5/h3,6H,1-2H2 |