| Approval: | ISO |
|---|---|
| IUPAC PIN: | 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylic acid |
| IUPAC name: | 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylic acid pre-1969 name: 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)picolinic acid |
| CAS name: | 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-2-pyridinecarboxylic acid |
| CAS Reg. No.: | 943832-60-8 |
| Formula: | C13H9Cl2FN2O3 |
| Activity: | herbicides (pyridinecarboxylic acid) |
| Notes: | Derivatives include halauxifen-methyl [943831-98-9]. |
| Structure: | |
| Pronunciation: | hǎl-orks-ǐ-fěn Guide to British pronunciation |
| InChIKey: | KKLBEFSLWYDQFI-UHFFFAOYSA-N |
| InChI: | InChI=1S/C13H9Cl2FN2O3/c1-21-12-6(14)3-2-5(10(12)16)8-4-7(17)9(15)11(18-8)13(19)20/h2-4H,1H3,(H2,17,18)(H,19,20) |
A data sheet from the Compendium of Pesticide Common Names