| Status: |
ISO 1750 (published) |
| IUPAC PIN: |
rac-ethyl (2E,4E,7R)-3,7,11-trimethyldodeca-2,4-dienoate |
| IUPAC name: |
ethyl (E,E)-(RS)-3,7,11-trimethyldodeca-2,4-dienoate |
| CAS name: |
ethyl (2E,4E)-3,7,11-trimethyl-2,4-dodecadienoate |
| CAS Reg. No.: |
41096-46-2 |
| Formula: |
C17H30O2 |
| Activity: |
insecticides (juvenile hormone mimic) |
| Notes: |
The (2E,4E,7S)-isomer [65733-18-8] is commercially available, but it does not have an ISO common name; the name “S-hydroprene” has been used in the literature, but it has no official status. |
| Structure: |
 |
| Pronunciation: |
hī-drō-prēn Guide to British pronunciation |
| InChIKey: |
FYQGBXGJFWXIPP-UEVLXMDPSA-N |
| InChI: |
InChI=1S/C17H30O2/c1-6-19-17(18)13-16(5)12-8-11-15(4)10-7-9-14(2)3/h8,12-15H,6-7,9-11H2,1-5H3/b12-8+,16-13+ |