| Approval: | ISO |
|---|---|
| IUPAC PIN: | N2-[(1R,2S)-2,6-dimethyl-2,3-dihydro-1H-inden-1-yl]-6-[(1Ξ)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine |
| IUPAC name: | N2-[(1R,2S)-2,3-dihydro-2,6-dimethyl-1H-inden-1-yl]-6-[(1RS)-1-fluoroethyl]-1,3,5-triazine-2,4-diamine |
| CAS name: | N2-[(1R,2S)-2,3-dihydro-2,6-dimethyl-1H-inden-1-yl]-6-(1-fluoroethyl)-1,3,5-triazine-2,4-diamine |
| CAS Reg. No.: | 950782-86-2 |
| Formula: | C16H20FN5 |
| Activity: | herbicides (alkylazine) |
| Notes: | The (1R)-1-fluoroethyl diastereomer [730979-19-8] and the (1S)-1-fluoroethyl diastereomer [730979-32-5] have nearly the same biological activity. |
| Structure: | |
| Pronunciation: | ǐn-dāz-ǐ-flǎm Guide to British pronunciation |
| InChIKey: | YFONKFDEZLYQDH-BOURZNODSA-N |
| InChI: | InChI=1S/C16H20FN5/c1-8-4-5-11-7-9(2)13(12(11)6-8)19-16-21-14(10(3)17)20-15(18)22-16/h4-6,9-10,13H,7H2,1-3H3,(H3,18,19,20,21,22)/t9-,10?,13+/m0/s1 |
A data sheet from the Compendium of Pesticide Common Names