| Approval: | ISO |
|---|---|
| IUPAC PIN: | 2-(propan-2-yl)phenyl methylcarbamate |
| IUPAC name: | 2-isopropylphenyl methylcarbamate 1979 Rules: o-cumenyl methylcarbamate |
| CAS name: | 2-(1-methylethyl)phenyl N-methylcarbamate |
| CAS Reg. No.: | 2631-40-5 |
| Formula: | C11H15NO2 |
| Activity: | insecticides (phenyl carbamate) |
| Notes: | The name “MIPC” is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries. |
| Structure: |  |
| Pronunciation: | ī-sō-prō-karb Guide to British pronunciation |
| InChIKey: | QBSJMKIUCUGGNG-UHFFFAOYSA-N |
| InChI: | InChI=1S/C11H15NO2/c1-8(2)9-6-4-5-7-10(9)14-11(13)12-3/h4-8H,1-3H3,(H,12,13) |