jasmonic acid

Chinese: 茉莉酸French: acide jasmonique (n.m.)Russian: жасмоновая кислота


Status: ISO 765 (published)
IUPAC PIN: {(1R,2R)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetic acid
IUPAC name: (1R,2R)-3-oxo-2-(Z)-pent-2-enylcyclopentylacetic acid
CAS name: (1R,2R)-3-oxo-2-(2Z)-2-pentenylcyclopentaneacetic acid
CAS Reg. No.: 6894-38-8
Formula: C12H18O3
Activity: plant growth regulators (growth inhibitor)
Notes: This substance is considered by the International Organization for Standardization not to require a common name.
Structure: Structural formula of jasmonic acid
Pronunciation: jǎz-mǒn-ǐk ǎs-ǐd  Guide to British pronunciation
InChIKey: ZNJFBWYDHIGLCU-HWKXXFMVSA-N
InChI: InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10-/m1/s1

A data sheet from the Compendium of Pesticide Common Names