Status: | ISO 765 (published) |
---|---|
IUPAC PIN: | {(1R,2R)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetic acid |
IUPAC name: | (1R,2R)-3-oxo-2-(Z)-pent-2-enylcyclopentylacetic acid |
CAS name: | (1R,2R)-3-oxo-2-(2Z)-2-pentenylcyclopentaneacetic acid |
CAS Reg. No.: | 6894-38-8 |
Formula: | C12H18O3 |
Activity: | plant growth regulators (growth inhibitor) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | jǎz-mǒn-ǐk ǎs-ǐd Guide to British pronunciation |
InChIKey: | ZNJFBWYDHIGLCU-HWKXXFMVSA-N |
InChI: | InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10-/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names