| Approval: | China |
|---|---|
| IUPAC PIN: | 2,2-dichloro-N-[2-oxo-2-(prop-2-en-1-ylamino)ethyl]-N-(prop-2-en-1-yl)acetamide |
| IUPAC name: | N-allyl-N-[(allylcarbamoyl)methyl]-2,2-dichloroacetamide |
| CAS name: | 2,2-dichloro-N-[2-oxo-2-(2-propen-1-ylamino)ethyl]-N-2-propen-1-ylacetamide |
| CAS Reg. No.: | 97454-00-7 |
| Formula: | C10H14Cl2N2O2 |
| Activity: | herbicide safeners |
| Notes: | There is no ISO common name for this substance; the name “jiecaoxi” (解草烯) is approved in China. |
| Structure: | |
| Pronunciation: | Guide to British pronunciation |
| InChIKey: | ZAWPDPLWGKAAHU-UHFFFAOYSA-N |
| InChI: | InChI=1S/C10H14Cl2N2O2/c1-3-5-13-8(15)7-14(6-4-2)10(16)9(11)12/h3-4,9H,1-2,5-7H2,(H,13,15) |
A data sheet from the Compendium of Pesticide Common Names