| Approval: | none |
|---|---|
| IUPAC PIN: | methyl (2E,6E)-9-[(2R,3S)-3-ethyl-3-methyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoate |
| IUPAC name: | methyl (2E,6E,10Z)-10,11-epoxy-3,7,11-trimethyl-2,6-tridecadienoate |
| CAS name: | methyl (2E,6E)-9-[(2R,3S)-3-ethyl-3-methyl-2-oxiranyl]-3,7-dimethyl-2,6-nonadienoate |
| CAS Reg. No.: | 34218-61-6 |
| Formula: | C17H28O3 |
| Activity: | insecticides (juvenile hormone) |
| Notes: | There is no ISO common name for this substance; the name “juvenile hormone II” has been used in the literature but it has no official approval. |
| Structure: | |
| Pronunciation: | joo-van-īl hor-mōn too Guide to British pronunciation |
| InChIKey: | CPVQJXZBSGXTGJ-TZDLBHCHSA-N |
| InChI: | InChI=1S/C17H28O3/c1-6-17(4)15(20-17)11-10-13(2)8-7-9-14(3)12-16(18)19-5/h8,12,15H,6-7,9-11H2,1-5H3/b13-8+,14-12+/t15-,17+/m1/s1 |
A data sheet from the Compendium of Pesticide Common Names