| Approval: | ISO |
|---|---|
| IUPAC PIN: | 2-(4-chlorophenyl)-1-ethyl-6-methyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid |
| IUPAC name: | 2-(4-chlorophenyl)-1-ethyl-6-methyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid 1979 Rules: 2-(4-chlorophenyl)-1-ethyl-1,4-dihydro-6-methyl-4-oxonicotinic acid |
| CAS name: | 2-(4-chlorophenyl)-1-ethyl-1,4-dihydro-6-methyl-4-oxo-3-pyridinecarboxylic acid |
| CAS Reg. No.: | 81051-65-2 |
| Formula: | C15H14ClNO3 |
| Activity: | plant growth regulators (gametocide) |
| Notes: | The name “chloretazate” has been used in the literature, but it has no official approval. Derivatives include karetazan-potassium [81052-29-1]. |
| Structure: |  |
| Pronunciation: | kar-ēt-a-zǎn Guide to British pronunciation |
| InChIKey: | GQFJDWYHPRLNHR-UHFFFAOYSA-N |
| InChI: | InChI=1S/C15H14ClNO3/c1-3-17-9(2)8-12(18)13(15(19)20)14(17)10-4-6-11(16)7-5-10/h4-8H,3H2,1-2H3,(H,19,20) |