Approval: | ISO common name not required |
---|---|
IUPAC PIN: | N-(furan-2-ylmethyl)-7H-purin-6-amine |
IUPAC name: | N-(2-furylmethyl)-7H-purin-6-amine 1979 Rules: N-furfuryladenine |
CAS name: | N-(2-furanylmethyl)-1H-purin-6-amine |
CAS Reg. No.: | 525-79-1 |
Formula: | C10H9N5O |
Activity: | plant growth regulators (cytokinin) |
Notes: | This substance is considered by the International Organization for Standardization not to require a common name. |
Structure: | |
Pronunciation: | kī-nǐ-tǐn Guide to British pronunciation |
InChIKey: | QANMHLXAZMSUEX-UHFFFAOYSA-N |
InChI: | InChI=1S/C10H9N5O/c1-2-7(16-3-1)4-11-9-8-10(13-5-12-8)15-6-14-9/h1-3,5-6H,4H2,(H2,11,12,13,14,15) |
A data sheet from the Compendium of Pesticide Common Names