| Approval: | none |
|---|---|
| IUPAC PIN: | mixture of (9Z,11E)-tetradeca-9,11-dien-1-yl acetate and (9Z,12E)-tetradeca-9,12-dien-1-yl acetate |
| IUPAC name: | mixture of (9Z,11E)-tetradeca-9,11-dien-1-yl acetate and (9Z,12E)-tetradeca-9,12-dien-1-yl acetate or mixture of (E,Z)-tetradeca-9,11-dien-1-yl acetate and (E,Z)-tetradeca-9,12-dien-1-yl acetate |
| CAS name: | (9Z,11E)-9,11-tetradecadien-1-yl acetate mixture with (9Z,12E)-9,12-tetradecadien-1-yl acetate |
| CAS Reg. No.: | 60799-74-8 |
| Formula: | C16H28O2 |
| Activity: | insect attractants (Lepidopteran) |
| Notes: | There is no ISO common name for this substance; the name “litlure” has been used in the literature but it has no official approval. This substance is named after the insect from which it was isolated, Spodoptera litura (Fabricius) (Noctuidae, Lepidoptera). |
| Structure: | |
| Pronunciation: | lǐt-lūr Guide to British pronunciation |
| InChIKey: | (9Z,11E)-9,11-tetradecadienyl acetate: RFEQLTBBKNKGGJ-DEQVHDEQSA-N (9Z,12E)-9,12-tetradecadienyl acetate: ZZGJZGSVLNSDPG-FDTUMDBZSA-N identifier for mixture (not valid): FNUMYEALEWCIOB-DSECXBNPSA-N |
| InChI: | (9Z,11E)-9,11-tetradecadienyl acetate: InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h4-7H,3,8-15H2,1-2H3/b5-4+,7-6- (9Z,12E)-9,12-tetradecadienyl acetate: InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h3-4,6-7H,5,8-15H2,1-2H3/b4-3+,7-6- |
A data sheet from the Compendium of Pesticide Common Names