| Approval: | ESA |
|---|---|
| IUPAC PIN: | mixture of (2Ξ)-butan-2-yl (1Ξ,2Ξ,4Ξ)-4-chloro-2-methylcyclohexane-1-carboxylate and (2Ξ)-butan-2-yl (1Ξ,2Ξ,5Ξ)-5-chloro-2-methylcyclohexane-1-carboxylate |
| IUPAC name: | (RS)-sec-butyl 4(or 5)-chloro-2-methylcyclohexanecarboxylate |
| CAS name: | 1-methylpropyl 4(or 5)-chloro-2-methylcyclohexanecarboxylate |
| CAS Reg. No.: | 13929-18-5 |
| Formula: | C12H21ClO2 |
| Activity: | insect attractants (Dipteran) |
| Notes: | There is no ISO common name for this substance; the name “medlure” is approved by the Entomological Society of America. This substance is named after the insect that it is used to attract, the Mediterranean fruit fly Ceratitis capitata (Wiedemann) (Tephritidae, Diptera). |
| Structure: | |
| Pronunciation: | měd-lūr Guide to British pronunciation |
| InChIKey: | 4-chloro isomer: CVDTYSSDCJAEQU-UHFFFAOYSA-N 5-chloro isomer: JRRZGLONQJCBTE-UHFFFAOYSA-N identifier for mixture (not valid): ZZZRZSOTRLRALD-UHFFFAOYSA-N |
| InChI: | 4-chloro isomer: InChI=1S/C12H21ClO2/c1-4-9(3)15-12(14)11-6-5-10(13)7-8(11)2/h8-11H,4-7H2,1-3H3 5-chloro isomer: InChI=1S/C12H21ClO2/c1-4-9(3)15-12(14)11-7-10(13)6-5-8(11)2/h8-11H,4-7H2,1-3H3 |
A data sheet from the Compendium of Pesticide Common Names